C31H42NO2+ — CID 35045395
(2S)-1-[4-(1-adamantyl)phenoxy]-3-(1-benzylpiperidin-1-ium-1-yl)propan-2-ol (PubChem CID 35045395) has the molecular formula C31H42NO2+ and a molecular weight of 460.68 g/mol. Its IUPAC name is (2S)-1-[4-(1-adamantyl)phenoxy]-3-(1-benzylpiperidin-1-ium-1-yl)propan-2-ol.
| Compound Name | (2S)-1-[4-(1-adamantyl)phenoxy]-3-(1-benzylpiperidin-1-ium-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 35045395 |
| Molecular Formula | C31H42NO2+ |
| Molecular Weight | 460.68 g/mol |
| Exact Mass | 460.32 |
| IUPAC Name | (2S)-1-[4-(1-adamantyl)phenoxy]-3-(1-benzylpiperidin-1-ium-1-yl)propan-2-ol |
| SMILES | O[C@H](COc1ccc(C23CC4CC(CC(C4)C2)C3)cc1)C[N+]1(Cc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C31H42NO2/c33-29(22-32(13-5-2-6-14-32)21-24-7-3-1-4-8-24)23-34-30-11-9-28(10-12-30)31-18-25-15-26(19-31)17-27(16-25)20-31/h1,3-4,7-12,25-27,29,33H,2,5-6,13-23H2/q+1/t25?,26?,27?,29-,31?/m0/s1 |
| InChIKey | RHQAJJSYCWISQT-MKRRAVBBSA-N |
| XLogP | 6.09 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.68 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|