C28H33N2O4+ — CID 100798764
(2R)-1-[1-[(4-nitrophenyl)methyl]azepan-1-ium-1-yl]-3-(4-phenylphenoxy)propan-2-ol (PubChem CID 100798764) has the molecular formula C28H33N2O4+ and a molecular weight of 461.58 g/mol. Its IUPAC name is (2R)-1-[1-[(4-nitrophenyl)methyl]azepan-1-ium-1-yl]-3-(4-phenylphenoxy)propan-2-ol.
| Compound Name | (2R)-1-[1-[(4-nitrophenyl)methyl]azepan-1-ium-1-yl]-3-(4-phenylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 100798764 |
| Molecular Formula | C28H33N2O4+ |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | (2R)-1-[1-[(4-nitrophenyl)methyl]azepan-1-ium-1-yl]-3-(4-phenylphenoxy)propan-2-ol |
| SMILES | O=[N+]([O-])c1ccc(C[N+]2(C[C@@H](O)COc3ccc(-c4ccccc4)cc3)CCCCCC2)cc1 |
| InChI | InChI=1S/C28H33N2O4/c31-27(22-34-28-16-12-25(13-17-28)24-8-4-3-5-9-24)21-30(18-6-1-2-7-19-30)20-23-10-14-26(15-11-23)29(32)33/h3-5,8-17,27,31H,1-2,6-7,18-22H2/q+1/t27-/m1/s1 |
| InChIKey | WULCCOGOFVCLJX-HHHXNRCGSA-N |
| XLogP | 5.59 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|