C26H30NO2+ — CID 51859235
(2R)-1-(1-benzylpyrrolidin-1-ium-1-yl)-3-(4-phenylphenoxy)propan-2-ol (PubChem CID 51859235) has the molecular formula C26H30NO2+ and a molecular weight of 388.53 g/mol. Its IUPAC name is (2R)-1-(1-benzylpyrrolidin-1-ium-1-yl)-3-(4-phenylphenoxy)propan-2-ol.
| Compound Name | (2R)-1-(1-benzylpyrrolidin-1-ium-1-yl)-3-(4-phenylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 51859235 |
| Molecular Formula | C26H30NO2+ |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | (2R)-1-(1-benzylpyrrolidin-1-ium-1-yl)-3-(4-phenylphenoxy)propan-2-ol |
| SMILES | O[C@@H](COc1ccc(-c2ccccc2)cc1)C[N+]1(Cc2ccccc2)CCCC1 |
| InChI | InChI=1S/C26H30NO2/c28-25(20-27(17-7-8-18-27)19-22-9-3-1-4-10-22)21-29-26-15-13-24(14-16-26)23-11-5-2-6-12-23/h1-6,9-16,25,28H,7-8,17-21H2/q+1/t25-/m1/s1 |
| InChIKey | GTRCMRDLVDZEKQ-RUZDIDTESA-N |
| XLogP | 4.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|