C24H34NO2+ — CID 51859215
(2S)-1-[(3R,5S)-1-ethyl-3,5-dimethylpiperidin-1-ium-1-yl]-3-(4-phenylphenoxy)propan-2-ol (PubChem CID 51859215) has the molecular formula C24H34NO2+ and a molecular weight of 368.54 g/mol. Its IUPAC name is (2S)-1-[(3R,5S)-1-ethyl-3,5-dimethylpiperidin-1-ium-1-yl]-3-(4-phenylphenoxy)propan-2-ol.
| Compound Name | (2S)-1-[(3R,5S)-1-ethyl-3,5-dimethylpiperidin-1-ium-1-yl]-3-(4-phenylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 51859215 |
| Molecular Formula | C24H34NO2+ |
| Molecular Weight | 368.54 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | (2S)-1-[(3R,5S)-1-ethyl-3,5-dimethylpiperidin-1-ium-1-yl]-3-(4-phenylphenoxy)propan-2-ol |
| SMILES | CC[N+]1(C[C@H](O)COc2ccc(-c3ccccc3)cc2)C[C@H](C)C[C@H](C)C1 |
| InChI | InChI=1S/C24H34NO2/c1-4-25(15-19(2)14-20(3)16-25)17-23(26)18-27-24-12-10-22(11-13-24)21-8-6-5-7-9-21/h5-13,19-20,23,26H,4,14-18H2,1-3H3/q+1/t19-,20+,23-,25?/m0/s1 |
| InChIKey | RQMGHMQKNALBEM-NTPPTQMCSA-N |
| XLogP | 4.61 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|