C26H29N2O4+ — CID 100798749
(2S)-1-[1-[(4-nitrophenyl)methyl]pyrrolidin-1-ium-1-yl]-3-(4-phenylphenoxy)propan-2-ol (PubChem CID 100798749) has the molecular formula C26H29N2O4+ and a molecular weight of 433.53 g/mol. Its IUPAC name is (2S)-1-[1-[(4-nitrophenyl)methyl]pyrrolidin-1-ium-1-yl]-3-(4-phenylphenoxy)propan-2-ol.
| Compound Name | (2S)-1-[1-[(4-nitrophenyl)methyl]pyrrolidin-1-ium-1-yl]-3-(4-phenylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 100798749 |
| Molecular Formula | C26H29N2O4+ |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | (2S)-1-[1-[(4-nitrophenyl)methyl]pyrrolidin-1-ium-1-yl]-3-(4-phenylphenoxy)propan-2-ol |
| SMILES | O=[N+]([O-])c1ccc(C[N+]2(C[C@H](O)COc3ccc(-c4ccccc4)cc3)CCCC2)cc1 |
| InChI | InChI=1S/C26H29N2O4/c29-25(20-32-26-14-10-23(11-15-26)22-6-2-1-3-7-22)19-28(16-4-5-17-28)18-21-8-12-24(13-9-21)27(30)31/h1-3,6-15,25,29H,4-5,16-20H2/q+1/t25-/m0/s1 |
| InChIKey | TYRBZMYNIYMAED-VWLOTQADSA-N |
| XLogP | 4.81 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|