C18H30NO2+ — CID 23966850
1-(1-butylpiperidin-1-ium-1-yl)-3-phenoxypropan-2-ol (PubChem CID 23966850) has the molecular formula C18H30NO2+ and a molecular weight of 292.44 g/mol. Its IUPAC name is 1-(1-butylpiperidin-1-ium-1-yl)-3-phenoxypropan-2-ol.
| Compound Name | 1-(1-butylpiperidin-1-ium-1-yl)-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 23966850 |
| Molecular Formula | C18H30NO2+ |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | 1-(1-butylpiperidin-1-ium-1-yl)-3-phenoxypropan-2-ol |
| SMILES | CCCC[N+]1(CC(O)COc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C18H30NO2/c1-2-3-12-19(13-8-5-9-14-19)15-17(20)16-21-18-10-6-4-7-11-18/h4,6-7,10-11,17,20H,2-3,5,8-9,12-16H2,1H3/q+1 |
| InChIKey | POTYSSPFHWRMCS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|