About 1-phenoxyheptan-2-ol
1-phenoxyheptan-2-ol (PubChem CID 12731443) has the molecular formula C13H20O2
and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-phenoxyheptan-2-ol.
Molecular Properties
| Compound Name | 1-phenoxyheptan-2-ol |
| PubChem CID | 12731443 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 1-phenoxyheptan-2-ol |
| SMILES | CCCCCC(O)COc1ccccc1 |
| InChI | InChI=1S/C13H20O2/c1-2-3-5-8-12(14)11-15-13-9-6-4-7-10-13/h4,6-7,9-10,12,14H,2-3,5,8,11H2,1H3 |
| InChIKey | CHPXWEVDOUBMSP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-phenoxyheptan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenoxyheptan-2-ol?
The IUPAC name of 1-phenoxyheptan-2-ol (CID 12731443) is 1-phenoxyheptan-2-ol.
What is the SMILES notation for 1-phenoxyheptan-2-ol?
The canonical SMILES for 1-phenoxyheptan-2-ol is CCCCCC(O)COc1ccccc1.
What is the InChIKey of 1-phenoxyheptan-2-ol?
The InChIKey is CHPXWEVDOUBMSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O2/c1-2-3-5-8-12(14)11-15-13-9-6-4-7-10-13/h4,6-7,9-10,12,14H,2-3,5,8,11H2,1H3.
What are the key properties of 1-phenoxyheptan-2-ol?
1-phenoxyheptan-2-ol has a molecular weight of 208.30 g/mol, XLogP of 3.01, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenoxyheptan-2-ol is sourced from PubChem (CID 12731443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).