C20H34O — CID 163303723
2,6-dimethyldodecoxybenzene (PubChem CID 163303723) has the molecular formula C20H34O and a molecular weight of 290.49 g/mol. Its IUPAC name is 2,6-dimethyldodecoxybenzene.
| Compound Name | 2,6-dimethyldodecoxybenzene |
|---|---|
| PubChem CID | 163303723 |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | 2,6-dimethyldodecoxybenzene |
| SMILES | CCCCCCC(C)CCCC(C)COc1ccccc1 |
| InChI | InChI=1S/C20H34O/c1-4-5-6-8-12-18(2)13-11-14-19(3)17-21-20-15-9-7-10-16-20/h7,9-10,15-16,18-19H,4-6,8,11-14,17H2,1-3H3 |
| InChIKey | GMWXJRLEUDOXPN-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|