About 1-phenoxytetradecan-2-ol
1-phenoxytetradecan-2-ol (PubChem CID 11609222) has the molecular formula C20H34O2
and a molecular weight of 306.49 g/mol. Its IUPAC name is 1-phenoxytetradecan-2-ol.
Molecular Properties
| Compound Name | 1-phenoxytetradecan-2-ol |
| PubChem CID | 11609222 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | 1-phenoxytetradecan-2-ol |
| SMILES | CCCCCCCCCCCCC(O)COc1ccccc1 |
| InChI | InChI=1S/C20H34O2/c1-2-3-4-5-6-7-8-9-10-12-15-19(21)18-22-20-16-13-11-14-17-20/h11,13-14,16-17,19,21H,2-10,12,15,18H2,1H3 |
| InChIKey | WWPKERGGWYAURZ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-phenoxytetradecan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenoxytetradecan-2-ol?
The IUPAC name of 1-phenoxytetradecan-2-ol (CID 11609222) is 1-phenoxytetradecan-2-ol.
What is the SMILES notation for 1-phenoxytetradecan-2-ol?
The canonical SMILES for 1-phenoxytetradecan-2-ol is CCCCCCCCCCCCC(O)COc1ccccc1.
What is the InChIKey of 1-phenoxytetradecan-2-ol?
The InChIKey is WWPKERGGWYAURZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34O2/c1-2-3-4-5-6-7-8-9-10-12-15-19(21)18-22-20-16-13-11-14-17-20/h11,13-14,16-17,19,21H,2-10,12,15,18H2,1H3.
What are the key properties of 1-phenoxytetradecan-2-ol?
1-phenoxytetradecan-2-ol has a molecular weight of 306.49 g/mol, XLogP of 5.74, 14 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenoxytetradecan-2-ol is sourced from PubChem (CID 11609222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).