C22H38O — CID 163303720
2,6-dimethyltetradecoxybenzene (PubChem CID 163303720) has the molecular formula C22H38O and a molecular weight of 318.54 g/mol. Its IUPAC name is 2,6-dimethyltetradecoxybenzene.
| Compound Name | 2,6-dimethyltetradecoxybenzene |
|---|---|
| PubChem CID | 163303720 |
| Molecular Formula | C22H38O |
| Molecular Weight | 318.54 g/mol |
| Exact Mass | 318.29 |
| IUPAC Name | 2,6-dimethyltetradecoxybenzene |
| SMILES | CCCCCCCCC(C)CCCC(C)COc1ccccc1 |
| InChI | InChI=1S/C22H38O/c1-4-5-6-7-8-10-14-20(2)15-13-16-21(3)19-23-22-17-11-9-12-18-22/h9,11-12,17-18,20-21H,4-8,10,13-16,19H2,1-3H3 |
| InChIKey | JFQJCFJPAOMXMW-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.54 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|