About 10-methyldodecoxybenzene
10-methyldodecoxybenzene (PubChem CID 143389992) has the molecular formula C19H32O
and a molecular weight of 276.46 g/mol. Its IUPAC name is 10-methyldodecoxybenzene.
Molecular Properties
| Compound Name | 10-methyldodecoxybenzene |
| PubChem CID | 143389992 |
| Molecular Formula | C19H32O |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.25 |
| IUPAC Name | 10-methyldodecoxybenzene |
| SMILES | CCC(C)CCCCCCCCCOc1ccccc1 |
| InChI | InChI=1S/C19H32O/c1-3-18(2)14-10-7-5-4-6-8-13-17-20-19-15-11-9-12-16-19/h9,11-12,15-16,18H,3-8,10,13-14,17H2,1-2H3 |
| InChIKey | GRTIAYDKIYPTNZ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 10-methyldodecoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methyldodecoxybenzene?
The IUPAC name of 10-methyldodecoxybenzene (CID 143389992) is 10-methyldodecoxybenzene.
What is the SMILES notation for 10-methyldodecoxybenzene?
The canonical SMILES for 10-methyldodecoxybenzene is CCC(C)CCCCCCCCCOc1ccccc1.
What is the InChIKey of 10-methyldodecoxybenzene?
The InChIKey is GRTIAYDKIYPTNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32O/c1-3-18(2)14-10-7-5-4-6-8-13-17-20-19-15-11-9-12-16-19/h9,11-12,15-16,18H,3-8,10,13-14,17H2,1-2H3.
What are the key properties of 10-methyldodecoxybenzene?
10-methyldodecoxybenzene has a molecular weight of 276.46 g/mol, XLogP of 6.23, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methyldodecoxybenzene is sourced from PubChem (CID 143389992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).