C20H28N2O — CID 173328271
2-[(7S)-7-methylnonoxy]-5-phenylpyrimidine (PubChem CID 173328271) has the molecular formula C20H28N2O and a molecular weight of 312.46 g/mol. Its IUPAC name is 2-[(7S)-7-methylnonoxy]-5-phenylpyrimidine.
| Compound Name | 2-[(7S)-7-methylnonoxy]-5-phenylpyrimidine |
|---|---|
| PubChem CID | 173328271 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | 2-[(7S)-7-methylnonoxy]-5-phenylpyrimidine |
| SMILES | CC[C@H](C)CCCCCCOc1ncc(-c2ccccc2)cn1 |
| InChI | InChI=1S/C20H28N2O/c1-3-17(2)11-7-4-5-10-14-23-20-21-15-19(16-22-20)18-12-8-6-9-13-18/h6,8-9,12-13,15-17H,3-5,7,10-11,14H2,1-2H3/t17-/m0/s1 |
| InChIKey | AJUTWZITZBVSBT-KRWDZBQOSA-N |
| XLogP | 5.52 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|