C13H18Cl2O — CID 90974620
7,7-dichloroheptoxybenzene (PubChem CID 90974620) has the molecular formula C13H18Cl2O and a molecular weight of 261.19 g/mol. Its IUPAC name is 7,7-dichloroheptoxybenzene.
| Compound Name | 7,7-dichloroheptoxybenzene |
|---|---|
| PubChem CID | 90974620 |
| Molecular Formula | C13H18Cl2O |
| Molecular Weight | 261.19 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 7,7-dichloroheptoxybenzene |
| SMILES | ClC(Cl)CCCCCCOc1ccccc1 |
| InChI | InChI=1S/C13H18Cl2O/c14-13(15)10-6-1-2-7-11-16-12-8-4-3-5-9-12/h3-5,8-9,13H,1-2,6-7,10-11H2 |
| InChIKey | JABUGMORSDZZLD-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.19 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|