C12H16Br2O — CID 91189511
5,6-dibromohexoxybenzene (PubChem CID 91189511) has the molecular formula C12H16Br2O and a molecular weight of 336.07 g/mol. Its IUPAC name is 5,6-dibromohexoxybenzene.
| Compound Name | 5,6-dibromohexoxybenzene |
|---|---|
| PubChem CID | 91189511 |
| Molecular Formula | C12H16Br2O |
| Molecular Weight | 336.07 g/mol |
| Exact Mass | 333.96 |
| IUPAC Name | 5,6-dibromohexoxybenzene |
| SMILES | BrCC(Br)CCCCOc1ccccc1 |
| InChI | InChI=1S/C12H16Br2O/c13-10-11(14)6-4-5-9-15-12-7-2-1-3-8-12/h1-3,7-8,11H,4-6,9-10H2 |
| InChIKey | CSVAFEZCEPALJE-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.07 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|