C20H34O3 — CID 123918890
14-phenoxytetradecane-1,13-diol (PubChem CID 123918890) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is 14-phenoxytetradecane-1,13-diol.
| Compound Name | 14-phenoxytetradecane-1,13-diol |
|---|---|
| PubChem CID | 123918890 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | 14-phenoxytetradecane-1,13-diol |
| SMILES | OCCCCCCCCCCCCC(O)COc1ccccc1 |
| InChI | InChI=1S/C20H34O3/c21-17-13-8-6-4-2-1-3-5-7-10-14-19(22)18-23-20-15-11-9-12-16-20/h9,11-12,15-16,19,21-22H,1-8,10,13-14,17-18H2 |
| InChIKey | LUBJJQDDKHRFOO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|