C18H30ClNO2 — CID 45283755
1-(1-benzylpyrrolidin-1-ium-1-yl)-3-butoxypropan-2-ol chloride (PubChem CID 45283755) has the molecular formula C18H30ClNO2 and a molecular weight of 327.90 g/mol. Its IUPAC name is 1-(1-benzylpyrrolidin-1-ium-1-yl)-3-butoxypropan-2-ol chloride.
| Compound Name | 1-(1-benzylpyrrolidin-1-ium-1-yl)-3-butoxypropan-2-ol chloride |
|---|---|
| PubChem CID | 45283755 |
| Molecular Formula | C18H30ClNO2 |
| Molecular Weight | 327.90 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | 1-(1-benzylpyrrolidin-1-ium-1-yl)-3-butoxypropan-2-ol chloride |
| SMILES | CCCCOCC(O)C[N+]1(Cc2ccccc2)CCCC1.[Cl-] |
| InChI | InChI=1S/C18H30NO2.ClH/c1-2-3-13-21-16-18(20)15-19(11-7-8-12-19)14-17-9-5-4-6-10-17;/h4-6,9-10,18,20H,2-3,7-8,11-16H2,1H3;1H/q+1;/p-1 |
| InChIKey | CLNWLULPOXNDAD-UHFFFAOYSA-M |
| XLogP | -0.02 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.90 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|