C27H40NO3+ — CID 100798586
(2R)-1-(1-benzylazepan-1-ium-1-yl)-3-(2-tert-butyl-4-methoxyphenoxy)propan-2-ol (PubChem CID 100798586) has the molecular formula C27H40NO3+ and a molecular weight of 426.62 g/mol. Its IUPAC name is (2R)-1-(1-benzylazepan-1-ium-1-yl)-3-(2-tert-butyl-4-methoxyphenoxy)propan-2-ol.
| Compound Name | (2R)-1-(1-benzylazepan-1-ium-1-yl)-3-(2-tert-butyl-4-methoxyphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 100798586 |
| Molecular Formula | C27H40NO3+ |
| Molecular Weight | 426.62 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | (2R)-1-(1-benzylazepan-1-ium-1-yl)-3-(2-tert-butyl-4-methoxyphenoxy)propan-2-ol |
| SMILES | COc1ccc(OC[C@H](O)C[N+]2(Cc3ccccc3)CCCCCC2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C27H40NO3/c1-27(2,3)25-18-24(30-4)14-15-26(25)31-21-23(29)20-28(16-10-5-6-11-17-28)19-22-12-8-7-9-13-22/h7-9,12-15,18,23,29H,5-6,10-11,16-17,19-21H2,1-4H3/q+1/t23-/m1/s1 |
| InChIKey | AUVQFRZFKKORQZ-HSZRJFAPSA-N |
| XLogP | 5.32 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.62 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|