C18H31NO4 — CID 39915376
2-[[(2R)-3-(2-tert-butyl-4-methoxyphenoxy)-2-hydroxypropyl]amino]-2-methylpropan-1-ol (PubChem CID 39915376) has the molecular formula C18H31NO4 and a molecular weight of 325.45 g/mol. Its IUPAC name is 2-[[(2R)-3-(2-tert-butyl-4-methoxyphenoxy)-2-hydroxypropyl]amino]-2-methylpropan-1-ol.
| Compound Name | 2-[[(2R)-3-(2-tert-butyl-4-methoxyphenoxy)-2-hydroxypropyl]amino]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 39915376 |
| Molecular Formula | C18H31NO4 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | 2-[[(2R)-3-(2-tert-butyl-4-methoxyphenoxy)-2-hydroxypropyl]amino]-2-methylpropan-1-ol |
| SMILES | COc1ccc(OC[C@H](O)CNC(C)(C)CO)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H31NO4/c1-17(2,3)15-9-14(22-6)7-8-16(15)23-11-13(21)10-19-18(4,5)12-20/h7-9,13,19-21H,10-12H2,1-6H3/t13-/m1/s1 |
| InChIKey | XEGMOMVDORTDGF-CYBMUJFWSA-N |
| XLogP | 2.09 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |