C24H37NO3 — CID 132585840
1-(1-adamantylamino)-3-(2-tert-butyl-4-methoxyphenoxy)propan-2-ol (PubChem CID 132585840) has the molecular formula C24H37NO3 and a molecular weight of 387.56 g/mol. Its IUPAC name is 1-(1-adamantylamino)-3-(2-tert-butyl-4-methoxyphenoxy)propan-2-ol.
| Compound Name | 1-(1-adamantylamino)-3-(2-tert-butyl-4-methoxyphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 132585840 |
| Molecular Formula | C24H37NO3 |
| Molecular Weight | 387.56 g/mol |
| Exact Mass | 387.28 |
| IUPAC Name | 1-(1-adamantylamino)-3-(2-tert-butyl-4-methoxyphenoxy)propan-2-ol |
| SMILES | COc1ccc(OCC(O)CNC23CC4CC(CC(C4)C2)C3)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H37NO3/c1-23(2,3)21-10-20(27-4)5-6-22(21)28-15-19(26)14-25-24-11-16-7-17(12-24)9-18(8-16)13-24/h5-6,10,16-19,25-26H,7-9,11-15H2,1-4H3 |
| InChIKey | OXDKYHCMSHTXFY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.56 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |