C18H31NO3 — CID 41135244
(2R)-1-(2-tert-butyl-4-methoxyphenoxy)-3-(2-methylpropylamino)propan-2-ol (PubChem CID 41135244) has the molecular formula C18H31NO3 and a molecular weight of 309.45 g/mol. Its IUPAC name is (2R)-1-(2-tert-butyl-4-methoxyphenoxy)-3-(2-methylpropylamino)propan-2-ol.
| Compound Name | (2R)-1-(2-tert-butyl-4-methoxyphenoxy)-3-(2-methylpropylamino)propan-2-ol |
|---|---|
| PubChem CID | 41135244 |
| Molecular Formula | C18H31NO3 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | (2R)-1-(2-tert-butyl-4-methoxyphenoxy)-3-(2-methylpropylamino)propan-2-ol |
| SMILES | COc1ccc(OC[C@H](O)CNCC(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H31NO3/c1-13(2)10-19-11-14(20)12-22-17-8-7-15(21-6)9-16(17)18(3,4)5/h7-9,13-14,19-20H,10-12H2,1-6H3/t14-/m1/s1 |
| InChIKey | GWVRZYKUHXLRIF-CQSZACIVSA-N |
| XLogP | 2.98 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |