C18H31NO5 — CID 7998304
(2R)-1-(2-tert-butyl-4-methoxyphenoxy)-3-[2-(2-hydroxyethoxy)ethylamino]propan-2-ol (PubChem CID 7998304) has the molecular formula C18H31NO5 and a molecular weight of 341.45 g/mol. Its IUPAC name is (2R)-1-(2-tert-butyl-4-methoxyphenoxy)-3-[2-(2-hydroxyethoxy)ethylamino]propan-2-ol.
| Compound Name | (2R)-1-(2-tert-butyl-4-methoxyphenoxy)-3-[2-(2-hydroxyethoxy)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 7998304 |
| Molecular Formula | C18H31NO5 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | (2R)-1-(2-tert-butyl-4-methoxyphenoxy)-3-[2-(2-hydroxyethoxy)ethylamino]propan-2-ol |
| SMILES | COc1ccc(OC[C@H](O)CNCCOCCO)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H31NO5/c1-18(2,3)16-11-15(22-4)5-6-17(16)24-13-14(21)12-19-7-9-23-10-8-20/h5-6,11,14,19-21H,7-10,12-13H2,1-4H3/t14-/m1/s1 |
| InChIKey | CMQOEVXWFDPEEL-CQSZACIVSA-N |
| XLogP | 1.33 |
| TPSA | 80.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|