C20H30ClNO3S — CID 138959124
1-(2-tert-butyl-4-methoxyphenoxy)-3-(1-thiophen-2-ylethylamino)propan-2-ol;hydrochloride (PubChem CID 138959124) has the molecular formula C20H30ClNO3S and a molecular weight of 399.98 g/mol. Its IUPAC name is 1-(2-tert-butyl-4-methoxyphenoxy)-3-(1-thiophen-2-ylethylamino)propan-2-ol;hydrochloride.
| Compound Name | 1-(2-tert-butyl-4-methoxyphenoxy)-3-(1-thiophen-2-ylethylamino)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 138959124 |
| Molecular Formula | C20H30ClNO3S |
| Molecular Weight | 399.98 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 1-(2-tert-butyl-4-methoxyphenoxy)-3-(1-thiophen-2-ylethylamino)propan-2-ol;hydrochloride |
| SMILES | COc1ccc(OCC(O)CNC(C)c2cccs2)c(C(C)(C)C)c1.Cl |
| InChI | InChI=1S/C20H29NO3S.ClH/c1-14(19-7-6-10-25-19)21-12-15(22)13-24-18-9-8-16(23-5)11-17(18)20(2,3)4;/h6-11,14-15,21-22H,12-13H2,1-5H3;1H |
| InChIKey | URQQGLDEJNMBTA-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.98 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |