C24H35NO3S — CID 138961003
1-(2-tert-butyl-4-methoxyphenoxy)-3-[[cyclopentyl(thiophen-2-yl)methyl]amino]propan-2-ol (PubChem CID 138961003) has the molecular formula C24H35NO3S and a molecular weight of 417.62 g/mol. Its IUPAC name is 1-(2-tert-butyl-4-methoxyphenoxy)-3-[[cyclopentyl(thiophen-2-yl)methyl]amino]propan-2-ol.
| Compound Name | 1-(2-tert-butyl-4-methoxyphenoxy)-3-[[cyclopentyl(thiophen-2-yl)methyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 138961003 |
| Molecular Formula | C24H35NO3S |
| Molecular Weight | 417.62 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 1-(2-tert-butyl-4-methoxyphenoxy)-3-[[cyclopentyl(thiophen-2-yl)methyl]amino]propan-2-ol |
| SMILES | COc1ccc(OCC(O)CNC(c2cccs2)C2CCCC2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H35NO3S/c1-24(2,3)20-14-19(27-4)11-12-21(20)28-16-18(26)15-25-23(17-8-5-6-9-17)22-10-7-13-29-22/h7,10-14,17-18,23,25-26H,5-6,8-9,15-16H2,1-4H3 |
| InChIKey | PPYSNMBHWBZSKE-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.62 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |