C21H27NO3S — CID 138961033
1-[2-[3-[[cyclopentyl(thiophen-2-yl)methyl]amino]-2-hydroxypropoxy]phenyl]ethanone (PubChem CID 138961033) has the molecular formula C21H27NO3S and a molecular weight of 373.52 g/mol. Its IUPAC name is 1-[2-[3-[[cyclopentyl(thiophen-2-yl)methyl]amino]-2-hydroxypropoxy]phenyl]ethanone.
| Compound Name | 1-[2-[3-[[cyclopentyl(thiophen-2-yl)methyl]amino]-2-hydroxypropoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 138961033 |
| Molecular Formula | C21H27NO3S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 1-[2-[3-[[cyclopentyl(thiophen-2-yl)methyl]amino]-2-hydroxypropoxy]phenyl]ethanone |
| SMILES | CC(=O)c1ccccc1OCC(O)CNC(c1cccs1)C1CCCC1 |
| InChI | InChI=1S/C21H27NO3S/c1-15(23)18-9-4-5-10-19(18)25-14-17(24)13-22-21(16-7-2-3-8-16)20-11-6-12-26-20/h4-6,9-12,16-17,21-22,24H,2-3,7-8,13-14H2,1H3 |
| InChIKey | LPMNNGCNHYVACQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |