C19H22ClNO3 — CID 138960383
1-[2-[3-[1-(4-chlorophenyl)ethylamino]-2-hydroxypropoxy]phenyl]ethanone (PubChem CID 138960383) has the molecular formula C19H22ClNO3 and a molecular weight of 347.84 g/mol. Its IUPAC name is 1-[2-[3-[1-(4-chlorophenyl)ethylamino]-2-hydroxypropoxy]phenyl]ethanone.
| Compound Name | 1-[2-[3-[1-(4-chlorophenyl)ethylamino]-2-hydroxypropoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 138960383 |
| Molecular Formula | C19H22ClNO3 |
| Molecular Weight | 347.84 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 1-[2-[3-[1-(4-chlorophenyl)ethylamino]-2-hydroxypropoxy]phenyl]ethanone |
| SMILES | CC(=O)c1ccccc1OCC(O)CNC(C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H22ClNO3/c1-13(15-7-9-16(20)10-8-15)21-11-17(23)12-24-19-6-4-3-5-18(19)14(2)22/h3-10,13,17,21,23H,11-12H2,1-2H3 |
| InChIKey | IVSUJGAOWPKNPN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.84 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |