C21H23Cl2NO2 — CID 138960501
1-[1-(3-chlorophenyl)ethylamino]-3-naphthalen-1-yloxypropan-2-ol;hydrochloride (PubChem CID 138960501) has the molecular formula C21H23Cl2NO2 and a molecular weight of 392.33 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)ethylamino]-3-naphthalen-1-yloxypropan-2-ol;hydrochloride.
| Compound Name | 1-[1-(3-chlorophenyl)ethylamino]-3-naphthalen-1-yloxypropan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 138960501 |
| Molecular Formula | C21H23Cl2NO2 |
| Molecular Weight | 392.33 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 1-[1-(3-chlorophenyl)ethylamino]-3-naphthalen-1-yloxypropan-2-ol;hydrochloride |
| SMILES | CC(NCC(O)COc1cccc2ccccc12)c1cccc(Cl)c1.Cl |
| InChI | InChI=1S/C21H22ClNO2.ClH/c1-15(17-8-4-9-18(22)12-17)23-13-19(24)14-25-21-11-5-7-16-6-2-3-10-20(16)21;/h2-12,15,19,23-24H,13-14H2,1H3;1H |
| InChIKey | WCBQKICJYGRYDM-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.33 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |