C17H20BrCl2NO2 — CID 138960458
1-(4-bromophenoxy)-3-[1-(3-chlorophenyl)ethylamino]propan-2-ol;hydrochloride (PubChem CID 138960458) has the molecular formula C17H20BrCl2NO2 and a molecular weight of 421.16 g/mol. Its IUPAC name is 1-(4-bromophenoxy)-3-[1-(3-chlorophenyl)ethylamino]propan-2-ol;hydrochloride.
| Compound Name | 1-(4-bromophenoxy)-3-[1-(3-chlorophenyl)ethylamino]propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 138960458 |
| Molecular Formula | C17H20BrCl2NO2 |
| Molecular Weight | 421.16 g/mol |
| Exact Mass | 419.01 |
| IUPAC Name | 1-(4-bromophenoxy)-3-[1-(3-chlorophenyl)ethylamino]propan-2-ol;hydrochloride |
| SMILES | CC(NCC(O)COc1ccc(Br)cc1)c1cccc(Cl)c1.Cl |
| InChI | InChI=1S/C17H19BrClNO2.ClH/c1-12(13-3-2-4-15(19)9-13)20-10-16(21)11-22-17-7-5-14(18)6-8-17;/h2-9,12,16,20-21H,10-11H2,1H3;1H |
| InChIKey | QRYACRHJZVSKRQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.16 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |