C19H24ClNO2 — CID 138960435
1-[1-(3-chlorophenyl)ethylamino]-3-(3,4-dimethylphenoxy)propan-2-ol (PubChem CID 138960435) has the molecular formula C19H24ClNO2 and a molecular weight of 333.86 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)ethylamino]-3-(3,4-dimethylphenoxy)propan-2-ol.
| Compound Name | 1-[1-(3-chlorophenyl)ethylamino]-3-(3,4-dimethylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 138960435 |
| Molecular Formula | C19H24ClNO2 |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 1-[1-(3-chlorophenyl)ethylamino]-3-(3,4-dimethylphenoxy)propan-2-ol |
| SMILES | Cc1ccc(OCC(O)CNC(C)c2cccc(Cl)c2)cc1C |
| InChI | InChI=1S/C19H24ClNO2/c1-13-7-8-19(9-14(13)2)23-12-18(22)11-21-15(3)16-5-4-6-17(20)10-16/h4-10,15,18,21-22H,11-12H2,1-3H3 |
| InChIKey | KHMSOQDDHOVRTA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |