About 1-(3,4-dimethylphenoxy)-3-(1-phenylethylamino)propan-2-ol chloride
1-(3,4-dimethylphenoxy)-3-(1-phenylethylamino)propan-2-ol chloride (PubChem CID 21237830) has the molecular formula C19H25ClNO2-
and a molecular weight of 334.87 g/mol. Its IUPAC name is 1-(3,4-dimethylphenoxy)-3-(1-phenylethylamino)propan-2-ol chloride.
Molecular Properties
| Compound Name | 1-(3,4-dimethylphenoxy)-3-(1-phenylethylamino)propan-2-ol chloride |
| PubChem CID | 21237830 |
| Molecular Formula | C19H25ClNO2- |
| Molecular Weight | 334.87 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 1-(3,4-dimethylphenoxy)-3-(1-phenylethylamino)propan-2-ol chloride |
| SMILES | Cc1ccc(OCC(O)CNC(C)c2ccccc2)cc1C.[Cl-] |
| InChI | InChI=1S/C19H25NO2.ClH/c1-14-9-10-19(11-15(14)2)22-13-18(21)12-20-16(3)17-7-5-4-6-8-17;/h4-11,16,18,20-21H,12-13H2,1-3H3;1H/p-1 |
| InChIKey | JYAVHGQGFLXPOP-UHFFFAOYSA-M |
| XLogP | 0.40 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.87 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3,4-dimethylphenoxy)-3-(1-phenylethylamino)propan-2-ol chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dimethylphenoxy)-3-(1-phenylethylamino)propan-2-ol chloride?
The IUPAC name of 1-(3,4-dimethylphenoxy)-3-(1-phenylethylamino)propan-2-ol chloride (CID 21237830) is 1-(3,4-dimethylphenoxy)-3-(1-phenylethylamino)propan-2-ol chloride.
What is the SMILES notation for 1-(3,4-dimethylphenoxy)-3-(1-phenylethylamino)propan-2-ol chloride?
The canonical SMILES for 1-(3,4-dimethylphenoxy)-3-(1-phenylethylamino)propan-2-ol chloride is Cc1ccc(OCC(O)CNC(C)c2ccccc2)cc1C.[Cl-].
What is the InChIKey of 1-(3,4-dimethylphenoxy)-3-(1-phenylethylamino)propan-2-ol chloride?
The InChIKey is JYAVHGQGFLXPOP-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H25NO2.ClH/c1-14-9-10-19(11-15(14)2)22-13-18(21)12-20-16(3)17-7-5-4-6-8-17;/h4-11,16,18,20-21H,12-13H2,1-3H3;1H/p-1.
What are the key properties of 1-(3,4-dimethylphenoxy)-3-(1-phenylethylamino)propan-2-ol chloride?
1-(3,4-dimethylphenoxy)-3-(1-phenylethylamino)propan-2-ol chloride has a molecular weight of 334.87 g/mol, XLogP of 0.40, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dimethylphenoxy)-3-(1-phenylethylamino)propan-2-ol chloride is sourced from PubChem (CID 21237830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).