C19H25ClNO2- — CID 21237830
1-(3,4-dimethylphenoxy)-3-(1-phenylethylamino)propan-2-ol chloride (PubChem CID 21237830) has the molecular formula C19H25ClNO2- and a molecular weight of 334.87 g/mol. Its IUPAC name is 1-(3,4-dimethylphenoxy)-3-(1-phenylethylamino)propan-2-ol chloride.
| Compound Name | 1-(3,4-dimethylphenoxy)-3-(1-phenylethylamino)propan-2-ol chloride |
|---|---|
| PubChem CID | 21237830 |
| Molecular Formula | C19H25ClNO2- |
| Molecular Weight | 334.87 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 1-(3,4-dimethylphenoxy)-3-(1-phenylethylamino)propan-2-ol chloride |
| SMILES | Cc1ccc(OCC(O)CNC(C)c2ccccc2)cc1C.[Cl-] |
| InChI | InChI=1S/C19H25NO2.ClH/c1-14-9-10-19(11-15(14)2)22-13-18(21)12-20-16(3)17-7-5-4-6-8-17;/h4-11,16,18,20-21H,12-13H2,1-3H3;1H/p-1 |
| InChIKey | JYAVHGQGFLXPOP-UHFFFAOYSA-M |
| XLogP | 0.40 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.87 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |