C21H29ClNO2- — CID 21237866
1-(2-tert-butylphenoxy)-3-(1-phenylethylamino)propan-2-ol chloride (PubChem CID 21237866) has the molecular formula C21H29ClNO2- and a molecular weight of 362.92 g/mol. Its IUPAC name is 1-(2-tert-butylphenoxy)-3-(1-phenylethylamino)propan-2-ol chloride.
| Compound Name | 1-(2-tert-butylphenoxy)-3-(1-phenylethylamino)propan-2-ol chloride |
|---|---|
| PubChem CID | 21237866 |
| Molecular Formula | C21H29ClNO2- |
| Molecular Weight | 362.92 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 1-(2-tert-butylphenoxy)-3-(1-phenylethylamino)propan-2-ol chloride |
| SMILES | CC(NCC(O)COc1ccccc1C(C)(C)C)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C21H29NO2.ClH/c1-16(17-10-6-5-7-11-17)22-14-18(23)15-24-20-13-9-8-12-19(20)21(2,3)4;/h5-13,16,18,22-23H,14-15H2,1-4H3;1H/p-1 |
| InChIKey | NIMARTFVIJVRFT-UHFFFAOYSA-M |
| XLogP | 1.08 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.92 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |