C21H30NO2+ — CID 7482163
[(2S)-3-(2-tert-butylphenoxy)-2-hydroxypropyl]-[(1R)-1-phenylethyl]azanium (PubChem CID 7482163) has the molecular formula C21H30NO2+ and a molecular weight of 328.48 g/mol. Its IUPAC name is [(2S)-3-(2-tert-butylphenoxy)-2-hydroxypropyl]-[(1R)-1-phenylethyl]azanium.
| Compound Name | [(2S)-3-(2-tert-butylphenoxy)-2-hydroxypropyl]-[(1R)-1-phenylethyl]azanium |
|---|---|
| PubChem CID | 7482163 |
| Molecular Formula | C21H30NO2+ |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | [(2S)-3-(2-tert-butylphenoxy)-2-hydroxypropyl]-[(1R)-1-phenylethyl]azanium |
| SMILES | C[C@@H]([NH2+]C[C@H](O)COc1ccccc1C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C21H29NO2/c1-16(17-10-6-5-7-11-17)22-14-18(23)15-24-20-13-9-8-12-19(20)21(2,3)4/h5-13,16,18,22-23H,14-15H2,1-4H3/p+1/t16-,18+/m1/s1 |
| InChIKey | QCDAHAHOFXFTEW-AEFFLSMTSA-O |
| XLogP | 3.05 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |