C20H28NO2+ — CID 6957345
[(2S)-2-hydroxy-3-(4-propylphenoxy)propyl]-[(1R)-1-phenylethyl]azanium (PubChem CID 6957345) has the molecular formula C20H28NO2+ and a molecular weight of 314.45 g/mol. Its IUPAC name is [(2S)-2-hydroxy-3-(4-propylphenoxy)propyl]-[(1R)-1-phenylethyl]azanium.
| Compound Name | [(2S)-2-hydroxy-3-(4-propylphenoxy)propyl]-[(1R)-1-phenylethyl]azanium |
|---|---|
| PubChem CID | 6957345 |
| Molecular Formula | C20H28NO2+ |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | [(2S)-2-hydroxy-3-(4-propylphenoxy)propyl]-[(1R)-1-phenylethyl]azanium |
| SMILES | CCCc1ccc(OC[C@@H](O)C[NH2+][C@H](C)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H27NO2/c1-3-7-17-10-12-20(13-11-17)23-15-19(22)14-21-16(2)18-8-5-4-6-9-18/h4-6,8-13,16,19,21-22H,3,7,14-15H2,1-2H3/p+1/t16-,19+/m1/s1 |
| InChIKey | BHCBMINIBNBATN-APWZRJJASA-O |
| XLogP | 2.70 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |