C18H27N4O2+ — CID 7176713
[(2R)-2-hydroxy-3-phenoxypropyl]-[2-[(5-propylpyrimidin-2-yl)amino]ethyl]azanium (PubChem CID 7176713) has the molecular formula C18H27N4O2+ and a molecular weight of 331.44 g/mol. Its IUPAC name is [(2R)-2-hydroxy-3-phenoxypropyl]-[2-[(5-propylpyrimidin-2-yl)amino]ethyl]azanium.
| Compound Name | [(2R)-2-hydroxy-3-phenoxypropyl]-[2-[(5-propylpyrimidin-2-yl)amino]ethyl]azanium |
|---|---|
| PubChem CID | 7176713 |
| Molecular Formula | C18H27N4O2+ |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | [(2R)-2-hydroxy-3-phenoxypropyl]-[2-[(5-propylpyrimidin-2-yl)amino]ethyl]azanium |
| SMILES | CCCc1cnc(NCC[NH2+]C[C@@H](O)COc2ccccc2)nc1 |
| InChI | InChI=1S/C18H26N4O2/c1-2-6-15-11-21-18(22-12-15)20-10-9-19-13-16(23)14-24-17-7-4-3-5-8-17/h3-5,7-8,11-12,16,19,23H,2,6,9-10,13-14H2,1H3,(H,20,21,22)/p+1/t16-/m1/s1 |
| InChIKey | ZOMPBDDUTRBQLP-MRXNPFEDSA-O |
| XLogP | 0.84 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|