C18H25Cl2N4O2+ — CID 7176695
[(2S)-3-(3,4-dichlorophenoxy)-2-hydroxypropyl]-[2-[(5-propylpyrimidin-2-yl)amino]ethyl]azanium (PubChem CID 7176695) has the molecular formula C18H25Cl2N4O2+ and a molecular weight of 400.33 g/mol. Its IUPAC name is [(2S)-3-(3,4-dichlorophenoxy)-2-hydroxypropyl]-[2-[(5-propylpyrimidin-2-yl)amino]ethyl]azanium.
| Compound Name | [(2S)-3-(3,4-dichlorophenoxy)-2-hydroxypropyl]-[2-[(5-propylpyrimidin-2-yl)amino]ethyl]azanium |
|---|---|
| PubChem CID | 7176695 |
| Molecular Formula | C18H25Cl2N4O2+ |
| Molecular Weight | 400.33 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | [(2S)-3-(3,4-dichlorophenoxy)-2-hydroxypropyl]-[2-[(5-propylpyrimidin-2-yl)amino]ethyl]azanium |
| SMILES | CCCc1cnc(NCC[NH2+]C[C@H](O)COc2ccc(Cl)c(Cl)c2)nc1 |
| InChI | InChI=1S/C18H24Cl2N4O2/c1-2-3-13-9-23-18(24-10-13)22-7-6-21-11-14(25)12-26-15-4-5-16(19)17(20)8-15/h4-5,8-10,14,21,25H,2-3,6-7,11-12H2,1H3,(H,22,23,24)/p+1/t14-/m0/s1 |
| InChIKey | KYRVIANWYTYSDU-AWEZNQCLSA-O |
| XLogP | 2.15 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|