C13H15Cl2NO2 — CID 114416471
1-(but-3-yn-2-ylamino)-3-(3,4-dichlorophenoxy)propan-2-ol (PubChem CID 114416471) has the molecular formula C13H15Cl2NO2 and a molecular weight of 288.17 g/mol. Its IUPAC name is 1-(but-3-yn-2-ylamino)-3-(3,4-dichlorophenoxy)propan-2-ol.
| Compound Name | 1-(but-3-yn-2-ylamino)-3-(3,4-dichlorophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 114416471 |
| Molecular Formula | C13H15Cl2NO2 |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 1-(but-3-yn-2-ylamino)-3-(3,4-dichlorophenoxy)propan-2-ol |
| SMILES | C#CC(C)NCC(O)COc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H15Cl2NO2/c1-3-9(2)16-7-10(17)8-18-11-4-5-12(14)13(15)6-11/h1,4-6,9-10,16-17H,7-8H2,2H3 |
| InChIKey | WQQCJQPPEMDWSU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|