C13H19Cl2NO3 — CID 82715506
1-(3,4-dichlorophenoxy)-3-(2-methylpropoxyamino)propan-2-ol (PubChem CID 82715506) has the molecular formula C13H19Cl2NO3 and a molecular weight of 308.20 g/mol. Its IUPAC name is 1-(3,4-dichlorophenoxy)-3-(2-methylpropoxyamino)propan-2-ol.
| Compound Name | 1-(3,4-dichlorophenoxy)-3-(2-methylpropoxyamino)propan-2-ol |
|---|---|
| PubChem CID | 82715506 |
| Molecular Formula | C13H19Cl2NO3 |
| Molecular Weight | 308.20 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 1-(3,4-dichlorophenoxy)-3-(2-methylpropoxyamino)propan-2-ol |
| SMILES | CC(C)CONCC(O)COc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H19Cl2NO3/c1-9(2)7-19-16-6-10(17)8-18-11-3-4-12(14)13(15)5-11/h3-5,9-10,16-17H,6-8H2,1-2H3 |
| InChIKey | QUPGBMMVYPEQRE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.20 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|