C18H21Cl2NO2 — CID 2725828
1-(3,4-dichlorophenoxy)-3-(4-propan-2-ylanilino)propan-2-ol (PubChem CID 2725828) has the molecular formula C18H21Cl2NO2 and a molecular weight of 354.28 g/mol. Its IUPAC name is 1-(3,4-dichlorophenoxy)-3-(4-propan-2-ylanilino)propan-2-ol.
| Compound Name | 1-(3,4-dichlorophenoxy)-3-(4-propan-2-ylanilino)propan-2-ol |
|---|---|
| PubChem CID | 2725828 |
| Molecular Formula | C18H21Cl2NO2 |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 1-(3,4-dichlorophenoxy)-3-(4-propan-2-ylanilino)propan-2-ol |
| SMILES | CC(C)c1ccc(NCC(O)COc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C18H21Cl2NO2/c1-12(2)13-3-5-14(6-4-13)21-10-15(22)11-23-16-7-8-17(19)18(20)9-16/h3-9,12,15,21-22H,10-11H2,1-2H3 |
| InChIKey | IPAWNNOSYAIVDS-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |