C9H10Cl2O3 — CID 78931944
3-(3,4-dichlorophenoxy)propane-1,2-diol (PubChem CID 78931944) has the molecular formula C9H10Cl2O3 and a molecular weight of 237.08 g/mol. Its IUPAC name is 3-(3,4-dichlorophenoxy)propane-1,2-diol.
| Compound Name | 3-(3,4-dichlorophenoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 78931944 |
| Molecular Formula | C9H10Cl2O3 |
| Molecular Weight | 237.08 g/mol |
| Exact Mass | 236.00 |
| IUPAC Name | 3-(3,4-dichlorophenoxy)propane-1,2-diol |
| SMILES | OCC(O)COc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H10Cl2O3/c10-8-2-1-7(3-9(8)11)14-5-6(13)4-12/h1-3,6,12-13H,4-5H2 |
| InChIKey | ZWAWJGMVHJXJGI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.08 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |