C23H32O3 — CID 142296403
1,3-bis(4-butylphenoxy)propan-2-ol (PubChem CID 142296403) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is 1,3-bis(4-butylphenoxy)propan-2-ol.
| Compound Name | 1,3-bis(4-butylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 142296403 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | 1,3-bis(4-butylphenoxy)propan-2-ol |
| SMILES | CCCCc1ccc(OCC(O)COc2ccc(CCCC)cc2)cc1 |
| InChI | InChI=1S/C23H32O3/c1-3-5-7-19-9-13-22(14-10-19)25-17-21(24)18-26-23-15-11-20(12-16-23)8-6-4-2/h9-16,21,24H,3-8,17-18H2,1-2H3 |
| InChIKey | WTDDHACMIIGDIP-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |