C14H22O2 — CID 142276328
1-(4-pentylphenoxy)propan-2-ol (PubChem CID 142276328) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-(4-pentylphenoxy)propan-2-ol.
| Compound Name | 1-(4-pentylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 142276328 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 1-(4-pentylphenoxy)propan-2-ol |
| SMILES | CCCCCc1ccc(OCC(C)O)cc1 |
| InChI | InChI=1S/C14H22O2/c1-3-4-5-6-13-7-9-14(10-8-13)16-11-12(2)15/h7-10,12,15H,3-6,11H2,1-2H3 |
| InChIKey | DRYBROJIEHQXEU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|