C18H23ClNO2+ — CID 6988816
[(2R)-3-(4-chloro-3-methylphenoxy)-2-hydroxypropyl]-[(1S)-1-phenylethyl]azanium (PubChem CID 6988816) has the molecular formula C18H23ClNO2+ and a molecular weight of 320.84 g/mol. Its IUPAC name is [(2R)-3-(4-chloro-3-methylphenoxy)-2-hydroxypropyl]-[(1S)-1-phenylethyl]azanium.
| Compound Name | [(2R)-3-(4-chloro-3-methylphenoxy)-2-hydroxypropyl]-[(1S)-1-phenylethyl]azanium |
|---|---|
| PubChem CID | 6988816 |
| Molecular Formula | C18H23ClNO2+ |
| Molecular Weight | 320.84 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | [(2R)-3-(4-chloro-3-methylphenoxy)-2-hydroxypropyl]-[(1S)-1-phenylethyl]azanium |
| SMILES | Cc1cc(OC[C@H](O)C[NH2+][C@@H](C)c2ccccc2)ccc1Cl |
| InChI | InChI=1S/C18H22ClNO2/c1-13-10-17(8-9-18(13)19)22-12-16(21)11-20-14(2)15-6-4-3-5-7-15/h3-10,14,16,20-21H,11-12H2,1-2H3/p+1/t14-,16+/m0/s1 |
| InChIKey | COZCCBGXWRWDCY-GOEBONIOSA-O |
| XLogP | 2.71 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.84 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |