C19H26NO2+ — CID 2514040
[(2S)-2-hydroxy-3-(3-methylphenoxy)propyl]-[(1R)-1-(2-methylphenyl)ethyl]azanium (PubChem CID 2514040) has the molecular formula C19H26NO2+ and a molecular weight of 300.42 g/mol. Its IUPAC name is [(2S)-2-hydroxy-3-(3-methylphenoxy)propyl]-[(1R)-1-(2-methylphenyl)ethyl]azanium.
| Compound Name | [(2S)-2-hydroxy-3-(3-methylphenoxy)propyl]-[(1R)-1-(2-methylphenyl)ethyl]azanium |
|---|---|
| PubChem CID | 2514040 |
| Molecular Formula | C19H26NO2+ |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | [(2S)-2-hydroxy-3-(3-methylphenoxy)propyl]-[(1R)-1-(2-methylphenyl)ethyl]azanium |
| SMILES | Cc1cccc(OC[C@@H](O)C[NH2+][C@H](C)c2ccccc2C)c1 |
| InChI | InChI=1S/C19H25NO2/c1-14-7-6-9-18(11-14)22-13-17(21)12-20-16(3)19-10-5-4-8-15(19)2/h4-11,16-17,20-21H,12-13H2,1-3H3/p+1/t16-,17+/m1/s1 |
| InChIKey | HZLNHHAVICFFEX-SJORKVTESA-O |
| XLogP | 2.37 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |