C17H30ClNO2 — CID 2873516
1-(tert-butylamino)-3-(2-tert-butylphenoxy)propan-2-ol;hydrochloride (PubChem CID 2873516) has the molecular formula C17H30ClNO2 and a molecular weight of 315.88 g/mol. Its IUPAC name is 1-(tert-butylamino)-3-(2-tert-butylphenoxy)propan-2-ol;hydrochloride.
| Compound Name | 1-(tert-butylamino)-3-(2-tert-butylphenoxy)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 2873516 |
| Molecular Formula | C17H30ClNO2 |
| Molecular Weight | 315.88 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | 1-(tert-butylamino)-3-(2-tert-butylphenoxy)propan-2-ol;hydrochloride |
| SMILES | CC(C)(C)NCC(O)COc1ccccc1C(C)(C)C.Cl |
| InChI | InChI=1S/C17H29NO2.ClH/c1-16(2,3)14-9-7-8-10-15(14)20-12-13(19)11-18-17(4,5)6;/h7-10,13,18-19H,11-12H2,1-6H3;1H |
| InChIKey | NUTCZUZGVLIJHJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.88 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |