C13H19F2NO2 — CID 115476114
1-(tert-butylamino)-3-(2,3-difluorophenoxy)propan-2-ol (PubChem CID 115476114) has the molecular formula C13H19F2NO2 and a molecular weight of 259.30 g/mol. Its IUPAC name is 1-(tert-butylamino)-3-(2,3-difluorophenoxy)propan-2-ol.
| Compound Name | 1-(tert-butylamino)-3-(2,3-difluorophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 115476114 |
| Molecular Formula | C13H19F2NO2 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 1-(tert-butylamino)-3-(2,3-difluorophenoxy)propan-2-ol |
| SMILES | CC(C)(C)NCC(O)COc1cccc(F)c1F |
| InChI | InChI=1S/C13H19F2NO2/c1-13(2,3)16-7-9(17)8-18-11-6-4-5-10(14)12(11)15/h4-6,9,16-17H,7-8H2,1-3H3 |
| InChIKey | OOTNFWFHAPYBTM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |