C21H23NO4 — CID 97356918
1-[(2S)-3-(tert-butylamino)-2-hydroxypropoxy]anthracene-9,10-dione (PubChem CID 97356918) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is 1-[(2S)-3-(tert-butylamino)-2-hydroxypropoxy]anthracene-9,10-dione.
| Compound Name | 1-[(2S)-3-(tert-butylamino)-2-hydroxypropoxy]anthracene-9,10-dione |
|---|---|
| PubChem CID | 97356918 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 1-[(2S)-3-(tert-butylamino)-2-hydroxypropoxy]anthracene-9,10-dione |
| SMILES | CC(C)(C)NC[C@H](O)COc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H23NO4/c1-21(2,3)22-11-13(23)12-26-17-10-6-9-16-18(17)20(25)15-8-5-4-7-14(15)19(16)24/h4-10,13,22-23H,11-12H2,1-3H3/t13-/m0/s1 |
| InChIKey | GBTWAPVFXUKHOI-ZDUSSCGKSA-N |
| XLogP | 2.59 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|