C18H25N3O7 — CID 70470728
3-[4-[3-(tert-butylamino)-2-hydroxypropoxy]-1,3-dioxoisoindol-2-yl]propyl nitrate (PubChem CID 70470728) has the molecular formula C18H25N3O7 and a molecular weight of 395.41 g/mol. Its IUPAC name is 3-[4-[3-(tert-butylamino)-2-hydroxypropoxy]-1,3-dioxoisoindol-2-yl]propyl nitrate.
| Compound Name | 3-[4-[3-(tert-butylamino)-2-hydroxypropoxy]-1,3-dioxoisoindol-2-yl]propyl nitrate |
|---|---|
| PubChem CID | 70470728 |
| Molecular Formula | C18H25N3O7 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 3-[4-[3-(tert-butylamino)-2-hydroxypropoxy]-1,3-dioxoisoindol-2-yl]propyl nitrate |
| SMILES | CC(C)(C)NCC(O)COc1cccc2c1C(=O)N(CCCO[N+](=O)[O-])C2=O |
| InChI | InChI=1S/C18H25N3O7/c1-18(2,3)19-10-12(22)11-27-14-7-4-6-13-15(14)17(24)20(16(13)23)8-5-9-28-21(25)26/h4,6-7,12,19,22H,5,8-11H2,1-3H3 |
| InChIKey | NOEKRPVYJFICER-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 131.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|