C21H31N3O7 — CID 70399573
[5-[[2-[[2-hydroxy-3-[(3-oxo-1,2-dihydroinden-4-yl)oxy]propyl]amino]-2-methylpropyl]amino]-5-oxopentyl] nitrate (PubChem CID 70399573) has the molecular formula C21H31N3O7 and a molecular weight of 437.49 g/mol. Its IUPAC name is [5-[[2-[[2-hydroxy-3-[(3-oxo-1,2-dihydroinden-4-yl)oxy]propyl]amino]-2-methylpropyl]amino]-5-oxopentyl] nitrate.
| Compound Name | [5-[[2-[[2-hydroxy-3-[(3-oxo-1,2-dihydroinden-4-yl)oxy]propyl]amino]-2-methylpropyl]amino]-5-oxopentyl] nitrate |
|---|---|
| PubChem CID | 70399573 |
| Molecular Formula | C21H31N3O7 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | [5-[[2-[[2-hydroxy-3-[(3-oxo-1,2-dihydroinden-4-yl)oxy]propyl]amino]-2-methylpropyl]amino]-5-oxopentyl] nitrate |
| SMILES | CC(C)(CNC(=O)CCCCO[N+](=O)[O-])NCC(O)COc1cccc2c1C(=O)CC2 |
| InChI | InChI=1S/C21H31N3O7/c1-21(2,14-22-19(27)8-3-4-11-31-24(28)29)23-12-16(25)13-30-18-7-5-6-15-9-10-17(26)20(15)18/h5-7,16,23,25H,3-4,8-14H2,1-2H3,(H,22,27) |
| InChIKey | AHYSMUCALINRGN-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 140.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|