C18H29N3O7 — CID 70399450
[4-[[2-[[2-hydroxy-3-(2-methoxyphenoxy)propyl]amino]-2-methylpropyl]amino]-4-oxobutan-2-yl] nitrate (PubChem CID 70399450) has the molecular formula C18H29N3O7 and a molecular weight of 399.44 g/mol. Its IUPAC name is [4-[[2-[[2-hydroxy-3-(2-methoxyphenoxy)propyl]amino]-2-methylpropyl]amino]-4-oxobutan-2-yl] nitrate.
| Compound Name | [4-[[2-[[2-hydroxy-3-(2-methoxyphenoxy)propyl]amino]-2-methylpropyl]amino]-4-oxobutan-2-yl] nitrate |
|---|---|
| PubChem CID | 70399450 |
| Molecular Formula | C18H29N3O7 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | [4-[[2-[[2-hydroxy-3-(2-methoxyphenoxy)propyl]amino]-2-methylpropyl]amino]-4-oxobutan-2-yl] nitrate |
| SMILES | COc1ccccc1OCC(O)CNC(C)(C)CNC(=O)CC(C)O[N+](=O)[O-] |
| InChI | InChI=1S/C18H29N3O7/c1-13(28-21(24)25)9-17(23)19-12-18(2,3)20-10-14(22)11-27-16-8-6-5-7-15(16)26-4/h5-8,13-14,20,22H,9-12H2,1-4H3,(H,19,23) |
| InChIKey | POLKZKFKBLLTCK-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 132.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|