C20H31N3O6 — CID 70381503
[4-[[2-[[2-hydroxy-3-(2-prop-2-enylphenoxy)propyl]amino]-2-methylpropyl]amino]-4-oxobutan-2-yl] nitrate (PubChem CID 70381503) has the molecular formula C20H31N3O6 and a molecular weight of 409.48 g/mol. Its IUPAC name is [4-[[2-[[2-hydroxy-3-(2-prop-2-enylphenoxy)propyl]amino]-2-methylpropyl]amino]-4-oxobutan-2-yl] nitrate.
| Compound Name | [4-[[2-[[2-hydroxy-3-(2-prop-2-enylphenoxy)propyl]amino]-2-methylpropyl]amino]-4-oxobutan-2-yl] nitrate |
|---|---|
| PubChem CID | 70381503 |
| Molecular Formula | C20H31N3O6 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | [4-[[2-[[2-hydroxy-3-(2-prop-2-enylphenoxy)propyl]amino]-2-methylpropyl]amino]-4-oxobutan-2-yl] nitrate |
| SMILES | C=CCc1ccccc1OCC(O)CNC(C)(C)CNC(=O)CC(C)O[N+](=O)[O-] |
| InChI | InChI=1S/C20H31N3O6/c1-5-8-16-9-6-7-10-18(16)28-13-17(24)12-22-20(3,4)14-21-19(25)11-15(2)29-23(26)27/h5-7,9-10,15,17,22,24H,1,8,11-14H2,2-4H3,(H,21,25) |
| InChIKey | LKRWUTWBDHUDMM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 122.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|