C24H38N4O8 — CID 88621540
[2-[2-[[2-[[2-hydroxy-3-[2-[1-(methylamino)-2-oxoethoxy]phenoxy]propyl]amino]-2-methylpropyl]amino]-2-oxoethyl]cyclohexyl] nitrate (PubChem CID 88621540) has the molecular formula C24H38N4O8 and a molecular weight of 510.59 g/mol. Its IUPAC name is [2-[2-[[2-[[2-hydroxy-3-[2-[1-(methylamino)-2-oxoethoxy]phenoxy]propyl]amino]-2-methylpropyl]amino]-2-oxoethyl]cyclohexyl] nitrate.
| Compound Name | [2-[2-[[2-[[2-hydroxy-3-[2-[1-(methylamino)-2-oxoethoxy]phenoxy]propyl]amino]-2-methylpropyl]amino]-2-oxoethyl]cyclohexyl] nitrate |
|---|---|
| PubChem CID | 88621540 |
| Molecular Formula | C24H38N4O8 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | [2-[2-[[2-[[2-hydroxy-3-[2-[1-(methylamino)-2-oxoethoxy]phenoxy]propyl]amino]-2-methylpropyl]amino]-2-oxoethyl]cyclohexyl] nitrate |
| SMILES | CNC(C=O)Oc1ccccc1OCC(O)CNC(C)(C)CNC(=O)CC1CCCCC1O[N+](=O)[O-] |
| InChI | InChI=1S/C24H38N4O8/c1-24(2,16-26-22(31)12-17-8-4-5-9-19(17)36-28(32)33)27-13-18(30)15-34-20-10-6-7-11-21(20)35-23(14-29)25-3/h6-7,10-11,14,17-19,23,25,27,30H,4-5,8-9,12-13,15-16H2,1-3H3,(H,26,31) |
| InChIKey | NGVXLKCSIYWRIM-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 161.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|